|
PVA Product Characteristics and Instruction for Use

PVA resin
is a kind of heavy polymer. It is white or light yellow floc, Granular
or powdery in appearance. Its molecular formula is[CH2CHOH]n,and
the molecular formula for some of the PVA is
[CH2CHOH]n[CH2CHOOCCH3]m.
PVA is non-toxic, insipid and harmless. PVA is water-soluble and the
solvent provide good viscosity and film building. It can withstand oils,
lubricants, hydrocarbons and most other organic so-lvents. PVA has better
chemical stability and insulatibility, and provide ease in firm
building; It possess the typical chemical properties of poly-ols and can
carry out process of esterifica-tion, etherealization, aceatal-ization
etc.
More>>>
partly alcoholysis
products
|
Product names |
Hydrolysis
(mol%) |
Viscosity
(cps) |
Volatiles
(%)≤ |
Ash
(%)≤ |
PH Value |
|
PVA05-88 |
86.0-90.0 |
4.0-6.0 |
7.0 |
0.5 |
5-7 |
|
PVA10-88 |
86.0-90.0 |
6.0-10.0 |
7.0 |
0.5 |
5-7 |
|
PVA12-88 |
86.0-90.0 |
9.0-13.0 |
7.0 |
0.5 |
5-7 |
|
PVA15-88 |
86.0-90.0 |
14.0-20.0 |
7.0 |
0.5 |
5-7 |
|
PVA15-92 |
90.0-94.0 |
15.0-21.0 |
7.0 |
0.5 |
5-7 |
|
PVA15-95 |
94.0-96.0 |
16.0-22.0 |
7.0 |
0.5 |
5-7 |
|
PVA17-88 |
86.0-90.0 |
20.0-26.0 |
7.0 |
0.5 |
5-7 |
|
PVA17-92 |
90.0-94.0 |
20.0-30.0 |
7.0 |
0.5 |
5-7 |
|
PVA17-95 |
94.0-96.0 |
20.0-30.0 |
7.0 |
0.5 |
5-7 |
|
PVA20-88 |
86.0-90.0 |
27.0-34.0 |
7.0 |
0.5 |
5-7 |
|
PVA20-92 |
90.0-94.0 |
29.0-36.0 |
7.0 |
0.5 |
5-7 |
|
PVA20-95 |
94.0-96.0 |
31.0-38.0 |
7.0 |
0.5 |
5-7 |
|
PVA22-88 |
86.0-90.0 |
35.0-43.0 |
7.0 |
0.5 |
5-7 |
|
PVA22-92 |
90.0-94.0 |
37.0-45.0 |
7.0 |
0.5 |
5-7 |
|
PVA22-95 |
94.0-96.0 |
39.0-47.0 |
7.0 |
0.5 |
5-7 |
|
PVA24-88 |
86.0-90.0 |
44.0-50.0 |
7.0 |
0.5 |
5-7 |
|
PVA24-92 |
90.0-94.0 |
46.0-52.0 |
7.0 |
0.5 |
5-7 |
|
PVA24-95 |
94.0-96.0 |
49.0-57.0 |
7.0 |
0.5 |
5-7 |
|
PVA26-88 |
86.0-90.0 |
50.0-58.0 |
7.0 |
0.5 |
5-7 |
|
PVA26-92 |
90.0-94.0 |
53.0-60.0 |
7.0 |
0.5 |
5-7 |
|
PVA26-95 |
94.0-96.0 |
56.0-63.0 |
7.0 |
0.5 |
5-7 |
Fully
alcoholysis products
|
Product names |
Hydrolysis
(mol%) |
Viscosity
(cps) |
Volatiles
(%)≤ |
Ash
(%)≤ |
PH Value |
|
PVA05-97 |
96.0-98.0 |
5.0-6.0 |
7.0 |
0.7 |
5-7 |
|
PVA05-99 |
98.0-100 |
4.0-7.0 |
7.0 |
0.7 |
5-7 |
|
PVA10-97 |
96.0-98.0 |
7.0-12.0 |
7.0 |
0.7 |
5-7 |
|
PVA10-99 |
98.0-100 |
8.0-13.0 |
7.0 |
0.7 |
5-7 |
|
PVA12-97 |
96.0-98.0 |
10.0-15.0 |
7.0 |
0.7 |
5-7 |
|
PVA12-99 |
98.0-100 |
11.0-16.0 |
7.0 |
0.7 |
5-7 |
|
PVA15-97 |
96.0-98.0 |
17.0-23.0 |
7.0 |
0.7 |
5-7 |
|
PVA15-99 |
98.0-100 |
18.0-24.0 |
7.0 |
0.7 |
5-7 |
|
PVA17-97 |
96.0-98.0 |
21.0-31.0 |
7.0 |
0.7 |
5-7 |
|
PVA17-99 |
98.0-100 |
21.0-31.0 |
7.0 |
0.7 |
5-7 |
|
PVA20-97 |
96.0-98.0 |
33.0-40.0 |
7.0 |
0.7 |
5-7 |
|
PVA20-99 |
98.0-100 |
35.0-44.0 |
7.0 |
0.7 |
5-7 |
|
PVA22-97 |
96.0-98.0 |
41.0-50.0 |
7.0 |
0.7 |
5-7 |
|
PVA22-99 |
98.0-100 |
44.0-54.0 |
7.0 |
0.7 |
5-7 |
|
PVA24-97 |
96.0-98.0 |
52.0-60.0 |
7.0 |
0.7 |
5-7 |
|
PVA24-99 |
98.0-100 |
55.0-64.0 |
7.0 |
0.7 |
5-7 |
|
PVA26-97 |
96.0-98.0 |
60.0-66.0 |
7.0 |
0.7 |
5-7 |
|
PVA26-99 |
98.0-100 |
64.0-70.0 |
7.0 |
0.7 |
5-7 |
|
|
Shanxi Sanwei
Group
Head
Quarter |
|
Hongtong
county
Shanxi province
041603 P.R. China
Tel: +86-357-6662688 Fax: +86-357-6661376
Email:sxsw@sxsanwei.com |
|
North American MKT
Contact |
Global Resource Holding Ltd.
Address: 58-2738,158th Street,
Surrey,BC, Canada.
V3S 3K3
Tel:
0016047625943 Fax:0016049987563
Email:globalrhlca@gmail.com
|
|
European MKT
Contact |
|
|
|
|
|
|
|